Chemistry:Pyrrolidonyl-beta-naphthylamide

Pyrrolidonyl-beta-naphthylamide

Names
IUPAC name N-(2-Naphthyl)-5-oxo-2-pyrrolidinecarboxamide
Identifiers
CAS Number	22155-91-5 N
3D model (JSmol)	Interactive image
ChemSpider	81932 Y
PubChem CID	90745
InChI InChI=1S/C15H14N2O2/c18-14-8-7-13(17-14)15(19)16-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,13H,7-8H2,(H,16,19)(H,17,18) Y Key: BZEPQNMASTUAMY-UHFFFAOYSA-N Y InChI=1/C15H14N2O2/c18-14-8-7-13(17-14)15(19)16-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,13H,7-8H2,(H,16,19)(H,17,18) Key: BZEPQNMASTUAMY-UHFFFAOYAS
SMILES O=C(Nc2cc1ccccc1cc2)C3NC(=O)CC3
Properties
Chemical formula	C15H14N2O2
Molar mass	254.28386
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
N verify (what is YN ?)
Infobox references

Pyrrolidonyl-beta-naphthylamide (PYR) is a molecule used in microbiology to detect the presence of pyrrolidonyl peptidase. In the presence of bacteria with pyrrolidonyl peptidase, it is broken down to pyroglutamic acid and 2-naphthylamine. To detect this process, p-dimethylaminocinnamaldehyde is added and a change to a pink color can then be detected.